C14H13N3O3 — CID 110488447
2-[(5-aminopyridine-3-carbonyl)amino]-5-methylbenzoic acid (PubChem CID 110488447) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[(5-aminopyridine-3-carbonyl)amino]-5-methylbenzoic acid.
| Compound Name | 2-[(5-aminopyridine-3-carbonyl)amino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 110488447 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[(5-aminopyridine-3-carbonyl)amino]-5-methylbenzoic acid |
| SMILES | Cc1ccc(NC(=O)c2cncc(N)c2)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H13N3O3/c1-8-2-3-12(11(4-8)14(19)20)17-13(18)9-5-10(15)7-16-6-9/h2-7H,15H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | VKHNLVQCCRUDSC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |