C15H14ClN3O4 — CID 110492036
methyl 5-chloro-2-methoxy-4-(pyridin-2-ylcarbamoylamino)benzoate (PubChem CID 110492036) has the molecular formula C15H14ClN3O4 and a molecular weight of 335.75 g/mol. Its IUPAC name is methyl 5-chloro-2-methoxy-4-(pyridin-2-ylcarbamoylamino)benzoate.
| Compound Name | methyl 5-chloro-2-methoxy-4-(pyridin-2-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 110492036 |
| Molecular Formula | C15H14ClN3O4 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | methyl 5-chloro-2-methoxy-4-(pyridin-2-ylcarbamoylamino)benzoate |
| SMILES | COC(=O)c1cc(Cl)c(NC(=O)Nc2ccccn2)cc1OC |
| InChI | InChI=1S/C15H14ClN3O4/c1-22-12-8-11(10(16)7-9(12)14(20)23-2)18-15(21)19-13-5-3-4-6-17-13/h3-8H,1-2H3,(H2,17,18,19,21) |
| InChIKey | PAWUPPHQFBBRJN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |