C14H19ClN2O5 — CID 95980182
methyl 5-chloro-4-[[(3S)-3-hydroxybutyl]carbamoylamino]-2-methoxybenzoate (PubChem CID 95980182) has the molecular formula C14H19ClN2O5 and a molecular weight of 330.77 g/mol. Its IUPAC name is methyl 5-chloro-4-[[(3S)-3-hydroxybutyl]carbamoylamino]-2-methoxybenzoate.
| Compound Name | methyl 5-chloro-4-[[(3S)-3-hydroxybutyl]carbamoylamino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 95980182 |
| Molecular Formula | C14H19ClN2O5 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl 5-chloro-4-[[(3S)-3-hydroxybutyl]carbamoylamino]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(Cl)c(NC(=O)NCC[C@H](C)O)cc1OC |
| InChI | InChI=1S/C14H19ClN2O5/c1-8(18)4-5-16-14(20)17-11-7-12(21-2)9(6-10(11)15)13(19)22-3/h6-8,18H,4-5H2,1-3H3,(H2,16,17,20)/t8-/m0/s1 |
| InChIKey | DHMMNDZUGKKXQN-QMMMGPOBSA-N |
| XLogP | 2.03 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |