C15H10N2O6 — CID 110494370
1,3-benzoxazol-5-yl 3-methoxy-4-nitrobenzoate (PubChem CID 110494370) has the molecular formula C15H10N2O6 and a molecular weight of 314.25 g/mol. Its IUPAC name is 1,3-benzoxazol-5-yl 3-methoxy-4-nitrobenzoate.
| Compound Name | 1,3-benzoxazol-5-yl 3-methoxy-4-nitrobenzoate |
|---|---|
| PubChem CID | 110494370 |
| Molecular Formula | C15H10N2O6 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1,3-benzoxazol-5-yl 3-methoxy-4-nitrobenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc3ocnc3c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10N2O6/c1-21-14-6-9(2-4-12(14)17(19)20)15(18)23-10-3-5-13-11(7-10)16-8-22-13/h2-8H,1H3 |
| InChIKey | PGERHTYYZBNMAH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|