C17H23NO5 — CID 110495229
2-[2-[[(E)-3-(3-propan-2-yloxyphenyl)prop-2-enoyl]amino]ethoxy]propanoic acid (PubChem CID 110495229) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[2-[[(E)-3-(3-propan-2-yloxyphenyl)prop-2-enoyl]amino]ethoxy]propanoic acid.
| Compound Name | 2-[2-[[(E)-3-(3-propan-2-yloxyphenyl)prop-2-enoyl]amino]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 110495229 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[2-[[(E)-3-(3-propan-2-yloxyphenyl)prop-2-enoyl]amino]ethoxy]propanoic acid |
| SMILES | CC(C)Oc1cccc(/C=C/C(=O)NCCOC(C)C(=O)O)c1 |
| InChI | InChI=1S/C17H23NO5/c1-12(2)23-15-6-4-5-14(11-15)7-8-16(19)18-9-10-22-13(3)17(20)21/h4-8,11-13H,9-10H2,1-3H3,(H,18,19)(H,20,21)/b8-7+ |
| InChIKey | KIZNCHQOSMFFIG-BQYQJAHWSA-N |
| XLogP | 2.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|