C10H17NO4 — CID 110495236
2-[2-(3-methylbut-2-enoylamino)ethoxy]propanoic acid (PubChem CID 110495236) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-[2-(3-methylbut-2-enoylamino)ethoxy]propanoic acid.
| Compound Name | 2-[2-(3-methylbut-2-enoylamino)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 110495236 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-[2-(3-methylbut-2-enoylamino)ethoxy]propanoic acid |
| SMILES | CC(C)=CC(=O)NCCOC(C)C(=O)O |
| InChI | InChI=1S/C10H17NO4/c1-7(2)6-9(12)11-4-5-15-8(3)10(13)14/h6,8H,4-5H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | CFVMGHQEOPHHJL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|