C23H28N2O4 — CID 110495402
1-[3-[[(3-ethoxybenzoyl)-methylamino]methyl]phenyl]piperidine-4-carboxylic acid (PubChem CID 110495402) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[3-[[(3-ethoxybenzoyl)-methylamino]methyl]phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[[(3-ethoxybenzoyl)-methylamino]methyl]phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 110495402 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[3-[[(3-ethoxybenzoyl)-methylamino]methyl]phenyl]piperidine-4-carboxylic acid |
| SMILES | CCOc1cccc(C(=O)N(C)Cc2cccc(N3CCC(C(=O)O)CC3)c2)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-3-29-21-9-5-7-19(15-21)22(26)24(2)16-17-6-4-8-20(14-17)25-12-10-18(11-13-25)23(27)28/h4-9,14-15,18H,3,10-13,16H2,1-2H3,(H,27,28) |
| InChIKey | ZCWGWFUUPXXLPU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |