C22H25N3O5 — CID 110495412
1-[3-[[methyl-(2-methyl-3-nitrobenzoyl)amino]methyl]phenyl]piperidine-4-carboxylic acid (PubChem CID 110495412) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 1-[3-[[methyl-(2-methyl-3-nitrobenzoyl)amino]methyl]phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[[methyl-(2-methyl-3-nitrobenzoyl)amino]methyl]phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 110495412 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[3-[[methyl-(2-methyl-3-nitrobenzoyl)amino]methyl]phenyl]piperidine-4-carboxylic acid |
| SMILES | Cc1c(C(=O)N(C)Cc2cccc(N3CCC(C(=O)O)CC3)c2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N3O5/c1-15-19(7-4-8-20(15)25(29)30)21(26)23(2)14-16-5-3-6-18(13-16)24-11-9-17(10-12-24)22(27)28/h3-8,13,17H,9-12,14H2,1-2H3,(H,27,28) |
| InChIKey | SCPFJXMGYIJAHR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|