C15H12BrFN2O2 — CID 110495829
(E)-N-(3-bromo-5-fluoro-2-pyridinyl)-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 110495829) has the molecular formula C15H12BrFN2O2 and a molecular weight of 351.18 g/mol. Its IUPAC name is (E)-N-(3-bromo-5-fluoro-2-pyridinyl)-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-bromo-5-fluoro-2-pyridinyl)-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 110495829 |
| Molecular Formula | C15H12BrFN2O2 |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | (E)-N-(3-bromo-5-fluoro-2-pyridinyl)-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ncc(F)cc2Br)c1 |
| InChI | InChI=1S/C15H12BrFN2O2/c1-21-12-4-2-3-10(7-12)5-6-14(20)19-15-13(16)8-11(17)9-18-15/h2-9H,1H3,(H,18,19,20)/b6-5+ |
| InChIKey | FIGMAGLFLPWFBA-AATRIKPKSA-N |
| XLogP | 3.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|