C26H27Cl4N3 — CID 11049647
4-[1,3-bis[(2,4-dichlorophenyl)methyl]-1,3-diazinan-2-yl]-N,N-dimethylaniline (PubChem CID 11049647) has the molecular formula C26H27Cl4N3 and a molecular weight of 523.34 g/mol. Its IUPAC name is 4-[1,3-bis[(2,4-dichlorophenyl)methyl]-1,3-diazinan-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[1,3-bis[(2,4-dichlorophenyl)methyl]-1,3-diazinan-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11049647 |
| Molecular Formula | C26H27Cl4N3 |
| Molecular Weight | 523.34 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 4-[1,3-bis[(2,4-dichlorophenyl)methyl]-1,3-diazinan-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2N(Cc3ccc(Cl)cc3Cl)CCCN2Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C26H27Cl4N3/c1-31(2)23-10-6-18(7-11-23)26-32(16-19-4-8-21(27)14-24(19)29)12-3-13-33(26)17-20-5-9-22(28)15-25(20)30/h4-11,14-15,26H,3,12-13,16-17H2,1-2H3 |
| InChIKey | GWKYDNMRAUFBDS-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.34 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|