C25H26Cl3N3 — CID 59261800
4-[[(3R)-3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]methyl]-N,N-dimethylaniline (PubChem CID 59261800) has the molecular formula C25H26Cl3N3 and a molecular weight of 474.86 g/mol. Its IUPAC name is 4-[[(3R)-3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[(3R)-3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59261800 |
| Molecular Formula | C25H26Cl3N3 |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 4-[[(3R)-3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CN2CCN(c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C25H26Cl3N3/c1-29(2)22-10-3-18(4-11-22)16-30-13-14-31(24-12-9-21(27)15-23(24)28)25(17-30)19-5-7-20(26)8-6-19/h3-12,15,25H,13-14,16-17H2,1-2H3/t25-/m0/s1 |
| InChIKey | SLTLGNJLMVXCOQ-VWLOTQADSA-N |
| XLogP | 6.78 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|