C25H25Cl3N2 — CID 11669776
2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(2-phenylpropyl)piperazine (PubChem CID 11669776) has the molecular formula C25H25Cl3N2 and a molecular weight of 459.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(2-phenylpropyl)piperazine.
| Compound Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(2-phenylpropyl)piperazine |
|---|---|
| PubChem CID | 11669776 |
| Molecular Formula | C25H25Cl3N2 |
| Molecular Weight | 459.85 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(2-phenylpropyl)piperazine |
| SMILES | CC(CN1CCN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C25H25Cl3N2/c1-18(19-5-3-2-4-6-19)16-29-13-14-30(24-12-11-22(27)15-23(24)28)25(17-29)20-7-9-21(26)10-8-20/h2-12,15,18,25H,13-14,16-17H2,1H3 |
| InChIKey | CYIFFZPGHOWKFD-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.85 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |