C26H24Cl3N3 — CID 123538536
2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2S)-2-(4-isocyanophenyl)propyl]piperazine (PubChem CID 123538536) has the molecular formula C26H24Cl3N3 and a molecular weight of 484.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2S)-2-(4-isocyanophenyl)propyl]piperazine.
| Compound Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2S)-2-(4-isocyanophenyl)propyl]piperazine |
|---|---|
| PubChem CID | 123538536 |
| Molecular Formula | C26H24Cl3N3 |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2S)-2-(4-isocyanophenyl)propyl]piperazine |
| SMILES | [C-]#[N+]c1ccc([C@H](C)CN2CCN(c3ccc(Cl)cc3Cl)C(c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C26H24Cl3N3/c1-18(19-5-10-23(30-2)11-6-19)16-31-13-14-32(25-12-9-22(28)15-24(25)29)26(17-31)20-3-7-21(27)8-4-20/h3-12,15,18,26H,13-14,16-17H2,1H3/t18-,26?/m1/s1 |
| InChIKey | TVTVKAFHOAAXKO-QOBPCVTDSA-N |
| XLogP | 7.86 |
| TPSA | 10.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|