C28H29Cl2N3O2 — CID 123951339
(2S)-1-[(3R)-4-[2-chloro-4-(methoxymethyl)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]-2-(4-isocyanophenyl)propan-2-ol (PubChem CID 123951339) has the molecular formula C28H29Cl2N3O2 and a molecular weight of 510.47 g/mol. Its IUPAC name is (2S)-1-[(3R)-4-[2-chloro-4-(methoxymethyl)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]-2-(4-isocyanophenyl)propan-2-ol.
| Compound Name | (2S)-1-[(3R)-4-[2-chloro-4-(methoxymethyl)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]-2-(4-isocyanophenyl)propan-2-ol |
|---|---|
| PubChem CID | 123951339 |
| Molecular Formula | C28H29Cl2N3O2 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | (2S)-1-[(3R)-4-[2-chloro-4-(methoxymethyl)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]-2-(4-isocyanophenyl)propan-2-ol |
| SMILES | [C-]#[N+]c1ccc([C@](C)(O)CN2CCN(c3ccc(COC)cc3Cl)[C@H](c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C28H29Cl2N3O2/c1-28(34,22-7-11-24(31-2)12-8-22)19-32-14-15-33(26-13-4-20(18-35-3)16-25(26)30)27(17-32)21-5-9-23(29)10-6-21/h4-13,16,27,34H,14-15,17-19H2,1,3H3/t27-,28+/m0/s1 |
| InChIKey | CHXFQGSNHXTTFK-WUFINQPMSA-N |
| XLogP | 6.46 |
| TPSA | 40.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|