C26H24Cl3N3O — CID 123934677
(2R)-1-[(3R)-3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-2-(4-isocyanophenyl)propan-2-ol (PubChem CID 123934677) has the molecular formula C26H24Cl3N3O and a molecular weight of 500.86 g/mol. Its IUPAC name is (2R)-1-[(3R)-3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-2-(4-isocyanophenyl)propan-2-ol.
| Compound Name | (2R)-1-[(3R)-3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-2-(4-isocyanophenyl)propan-2-ol |
|---|---|
| PubChem CID | 123934677 |
| Molecular Formula | C26H24Cl3N3O |
| Molecular Weight | 500.86 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | (2R)-1-[(3R)-3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-2-(4-isocyanophenyl)propan-2-ol |
| SMILES | [C-]#[N+]c1ccc([C@@](C)(O)CN2CCN(c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C26H24Cl3N3O/c1-26(33,19-5-10-22(30-2)11-6-19)17-31-13-14-32(24-12-9-21(28)15-23(24)29)25(16-31)18-3-7-20(27)8-4-18/h3-12,15,25,33H,13-14,16-17H2,1H3/t25-,26-/m0/s1 |
| InChIKey | BPAJPHYJCCKODM-UIOOFZCWSA-N |
| XLogP | 6.97 |
| TPSA | 31.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.86 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|