C27H24Cl2N4 — CID 123712747
3-chloro-4-[2-(4-chlorophenyl)-4-[(2S)-2-(4-isocyanophenyl)propyl]piperazin-1-yl]benzonitrile (PubChem CID 123712747) has the molecular formula C27H24Cl2N4 and a molecular weight of 475.42 g/mol. Its IUPAC name is 3-chloro-4-[2-(4-chlorophenyl)-4-[(2S)-2-(4-isocyanophenyl)propyl]piperazin-1-yl]benzonitrile.
| Compound Name | 3-chloro-4-[2-(4-chlorophenyl)-4-[(2S)-2-(4-isocyanophenyl)propyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 123712747 |
| Molecular Formula | C27H24Cl2N4 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-chloro-4-[2-(4-chlorophenyl)-4-[(2S)-2-(4-isocyanophenyl)propyl]piperazin-1-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc([C@H](C)CN2CCN(c3ccc(C#N)cc3Cl)C(c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C27H24Cl2N4/c1-19(21-6-10-24(31-2)11-7-21)17-32-13-14-33(26-12-3-20(16-30)15-25(26)29)27(18-32)22-4-8-23(28)9-5-22/h3-12,15,19,27H,13-14,17-18H2,1H3/t19-,27?/m1/s1 |
| InChIKey | RIRAFAFRWVMXBP-FOEZPWHWSA-N |
| XLogP | 7.08 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|