C27H26Cl2N4O3 — CID 90775874
4-[2-[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]-1-nitrosoethyl]benzonitrile (PubChem CID 90775874) has the molecular formula C27H26Cl2N4O3 and a molecular weight of 525.44 g/mol. Its IUPAC name is 4-[2-[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]-1-nitrosoethyl]benzonitrile.
| Compound Name | 4-[2-[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]-1-nitrosoethyl]benzonitrile |
|---|---|
| PubChem CID | 90775874 |
| Molecular Formula | C27H26Cl2N4O3 |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 4-[2-[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]-1-nitrosoethyl]benzonitrile |
| SMILES | N#Cc1ccc(C(CN2CCN(c3ccc(OCCO)cc3Cl)[C@H](c3ccc(Cl)cc3)C2)N=O)cc1 |
| InChI | InChI=1S/C27H26Cl2N4O3/c28-22-7-5-21(6-8-22)27-18-32(17-25(31-35)20-3-1-19(16-30)2-4-20)11-12-33(27)26-10-9-23(15-24(26)29)36-14-13-34/h1-10,15,25,27,34H,11-14,17-18H2/t25?,27-/m0/s1 |
| InChIKey | WHEHRAACEAKTGC-GPNIZQGCSA-N |
| XLogP | 5.61 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|