C28H29Cl2N3O2 — CID 71021341
4-[2-[(3R)-4-[2-chloro-4-(2-hydroxypropoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]benzonitrile (PubChem CID 71021341) has the molecular formula C28H29Cl2N3O2 and a molecular weight of 510.47 g/mol. Its IUPAC name is 4-[2-[(3R)-4-[2-chloro-4-(2-hydroxypropoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]benzonitrile.
| Compound Name | 4-[2-[(3R)-4-[2-chloro-4-(2-hydroxypropoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 71021341 |
| Molecular Formula | C28H29Cl2N3O2 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 4-[2-[(3R)-4-[2-chloro-4-(2-hydroxypropoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]benzonitrile |
| SMILES | CC(O)COc1ccc(N2CCN(CCc3ccc(C#N)cc3)C[C@H]2c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C28H29Cl2N3O2/c1-20(34)19-35-25-10-11-27(26(30)16-25)33-15-14-32(13-12-21-2-4-22(17-31)5-3-21)18-28(33)23-6-8-24(29)9-7-23/h2-11,16,20,28,34H,12-15,18-19H2,1H3/t20?,28-/m0/s1 |
| InChIKey | PQUACNIRRDDQPE-GPIXMLASSA-N |
| XLogP | 5.73 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|