C29H32ClN3O3 — CID 25166527
4-[(2S)-1-[(3R)-4-[2-chloro-4-[(2R)-2-hydroxypropoxy]phenyl]-3-phenylpiperazin-1-yl]-2-hydroxypropan-2-yl]benzonitrile (PubChem CID 25166527) has the molecular formula C29H32ClN3O3 and a molecular weight of 506.05 g/mol. Its IUPAC name is 4-[(2S)-1-[(3R)-4-[2-chloro-4-[(2R)-2-hydroxypropoxy]phenyl]-3-phenylpiperazin-1-yl]-2-hydroxypropan-2-yl]benzonitrile.
| Compound Name | 4-[(2S)-1-[(3R)-4-[2-chloro-4-[(2R)-2-hydroxypropoxy]phenyl]-3-phenylpiperazin-1-yl]-2-hydroxypropan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 25166527 |
| Molecular Formula | C29H32ClN3O3 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 4-[(2S)-1-[(3R)-4-[2-chloro-4-[(2R)-2-hydroxypropoxy]phenyl]-3-phenylpiperazin-1-yl]-2-hydroxypropan-2-yl]benzonitrile |
| SMILES | C[C@@H](O)COc1ccc(N2CCN(C[C@@](C)(O)c3ccc(C#N)cc3)C[C@H]2c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C29H32ClN3O3/c1-21(34)19-36-25-12-13-27(26(30)16-25)33-15-14-32(18-28(33)23-6-4-3-5-7-23)20-29(2,35)24-10-8-22(17-31)9-11-24/h3-13,16,21,28,34-35H,14-15,18-20H2,1-2H3/t21-,28+,29-/m1/s1 |
| InChIKey | UCHZYOCXDNEZLO-SPTGULJVSA-N |
| XLogP | 4.74 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|