C27H25ClN4O2 — CID 71021295
4-[[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-cyanophenyl)piperazin-1-yl]methyl]benzonitrile (PubChem CID 71021295) has the molecular formula C27H25ClN4O2 and a molecular weight of 472.98 g/mol. Its IUPAC name is 4-[[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-cyanophenyl)piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-cyanophenyl)piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 71021295 |
| Molecular Formula | C27H25ClN4O2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 4-[[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-cyanophenyl)piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCN(c3ccc(OCCO)cc3Cl)[C@H](c3ccc(C#N)cc3)C2)cc1 |
| InChI | InChI=1S/C27H25ClN4O2/c28-25-15-24(34-14-13-33)9-10-26(25)32-12-11-31(18-22-3-1-20(16-29)2-4-22)19-27(32)23-7-5-21(17-30)6-8-23/h1-10,15,27,33H,11-14,18-19H2/t27-/m0/s1 |
| InChIKey | MDLSYFCICRINQY-MHZLTWQESA-N |
| XLogP | 4.52 |
| TPSA | 83.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|