C31H39Cl3N4O4 — CID 160977996
2-[3-chloro-4-[(2R)-2-(4-chlorophenyl)piperazin-1-yl]phenoxy]ethanol;2-[3-chloro-4-[(2S)-2-methylpiperazin-1-yl]phenoxy]ethanol (PubChem CID 160977996) has the molecular formula C31H39Cl3N4O4 and a molecular weight of 638.04 g/mol. Its IUPAC name is 2-[3-chloro-4-[(2R)-2-(4-chlorophenyl)piperazin-1-yl]phenoxy]ethanol;2-[3-chloro-4-[(2S)-2-methylpiperazin-1-yl]phenoxy]ethanol.
| Compound Name | 2-[3-chloro-4-[(2R)-2-(4-chlorophenyl)piperazin-1-yl]phenoxy]ethanol;2-[3-chloro-4-[(2S)-2-methylpiperazin-1-yl]phenoxy]ethanol |
|---|---|
| PubChem CID | 160977996 |
| Molecular Formula | C31H39Cl3N4O4 |
| Molecular Weight | 638.04 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | 2-[3-chloro-4-[(2R)-2-(4-chlorophenyl)piperazin-1-yl]phenoxy]ethanol;2-[3-chloro-4-[(2S)-2-methylpiperazin-1-yl]phenoxy]ethanol |
| SMILES | C[C@H]1CNCCN1c1ccc(OCCO)cc1Cl.OCCOc1ccc(N2CCNC[C@H]2c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N2O2.C13H19ClN2O2/c19-14-3-1-13(2-4-14)18-12-21-7-8-22(18)17-6-5-15(11-16(17)20)24-10-9-23;1-10-9-15-4-5-16(10)13-3-2-11(8-12(13)14)18-7-6-17/h1-6,11,18,21,23H,7-10,12H2;2-3,8,10,15,17H,4-7,9H2,1H3/t18-;10-/m00/s1 |
| InChIKey | SZDAFWHOYDWPQJ-HPFFKBGWSA-N |
| XLogP | 5.02 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.04 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|