C27H27ClFN3O3 — CID 25165553
4-[(1S)-1-[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-fluorophenyl)piperazin-1-yl]-2-hydroxyethyl]benzonitrile (PubChem CID 25165553) has the molecular formula C27H27ClFN3O3 and a molecular weight of 495.98 g/mol. Its IUPAC name is 4-[(1S)-1-[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-fluorophenyl)piperazin-1-yl]-2-hydroxyethyl]benzonitrile.
| Compound Name | 4-[(1S)-1-[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-fluorophenyl)piperazin-1-yl]-2-hydroxyethyl]benzonitrile |
|---|---|
| PubChem CID | 25165553 |
| Molecular Formula | C27H27ClFN3O3 |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 4-[(1S)-1-[(3R)-4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-fluorophenyl)piperazin-1-yl]-2-hydroxyethyl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H](CO)N2CCN(c3ccc(OCCO)cc3Cl)[C@H](c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C27H27ClFN3O3/c28-24-15-23(35-14-13-33)9-10-25(24)32-12-11-31(17-26(32)20-5-7-22(29)8-6-20)27(18-34)21-3-1-19(16-30)2-4-21/h1-10,15,26-27,33-34H,11-14,17-18H2/t26-,27+/m0/s1 |
| InChIKey | JVCGMJLPTMVSDS-RRPNLBNLSA-N |
| XLogP | 4.32 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|