C28H30Cl2N2O4 — CID 71231331
methyl 4-[1-[4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]benzoate (PubChem CID 71231331) has the molecular formula C28H30Cl2N2O4 and a molecular weight of 529.46 g/mol. Its IUPAC name is methyl 4-[1-[4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]benzoate.
| Compound Name | methyl 4-[1-[4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 71231331 |
| Molecular Formula | C28H30Cl2N2O4 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | methyl 4-[1-[4-[2-chloro-4-(2-hydroxyethoxy)phenyl]-3-(4-chlorophenyl)piperazin-1-yl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(C(C)N2CCN(c3ccc(OCCO)cc3Cl)C(c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C28H30Cl2N2O4/c1-19(20-3-5-22(6-4-20)28(34)35-2)31-13-14-32(27(18-31)21-7-9-23(29)10-8-21)26-12-11-24(17-25(26)30)36-16-15-33/h3-12,17,19,27,33H,13-16,18H2,1-2H3 |
| InChIKey | PMXNFYYPQJHXBI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|