C17H15Cl2F3N2 — CID 59261431
1-(2,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]piperazine (PubChem CID 59261431) has the molecular formula C17H15Cl2F3N2 and a molecular weight of 375.22 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-(2,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 59261431 |
| Molecular Formula | C17H15Cl2F3N2 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1ccc(C2CNCCN2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2F3N2/c18-13-5-6-15(14(19)9-13)24-8-7-23-10-16(24)11-1-3-12(4-2-11)17(20,21)22/h1-6,9,16,23H,7-8,10H2 |
| InChIKey | KHJZWKPXPKDGKN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |