C17H17Cl3N2 — CID 58956932
(2S,4R)-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidin-4-amine (PubChem CID 58956932) has the molecular formula C17H17Cl3N2 and a molecular weight of 355.70 g/mol. Its IUPAC name is (2S,4R)-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidin-4-amine.
| Compound Name | (2S,4R)-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 58956932 |
| Molecular Formula | C17H17Cl3N2 |
| Molecular Weight | 355.70 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (2S,4R)-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidin-4-amine |
| SMILES | N[C@@H]1CCN(c2ccc(Cl)cc2Cl)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H17Cl3N2/c18-12-3-1-11(2-4-12)17-10-14(21)7-8-22(17)16-6-5-13(19)9-15(16)20/h1-6,9,14,17H,7-8,10,21H2/t14-,17+/m1/s1 |
| InChIKey | WCYMXLNQHTVASX-PBHICJAKSA-N |
| XLogP | 5.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |