C17H16Cl3N — CID 71176112
2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidine (PubChem CID 71176112) has the molecular formula C17H16Cl3N and a molecular weight of 340.68 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidine.
| Compound Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidine |
|---|---|
| PubChem CID | 71176112 |
| Molecular Formula | C17H16Cl3N |
| Molecular Weight | 340.68 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidine |
| SMILES | Clc1ccc(C2CCCCN2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl3N/c18-13-6-4-12(5-7-13)16-3-1-2-10-21(16)17-9-8-14(19)11-15(17)20/h4-9,11,16H,1-3,10H2 |
| InChIKey | LPZOYEDOQPAHHF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.68 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |