About 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine
2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine (PubChem CID 143237546) has the molecular formula C25H25Cl3N2O
and a molecular weight of 475.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine |
| PubChem CID | 143237546 |
| Molecular Formula | C25H25Cl3N2O |
| Molecular Weight | 475.85 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine |
| SMILES | CC(OCN1CCN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C25H25Cl3N2O/c1-18(19-5-3-2-4-6-19)31-17-29-13-14-30(24-12-11-22(27)15-23(24)28)25(16-29)20-7-9-21(26)10-8-20/h2-12,15,18,25H,13-14,16-17H2,1H3 |
| InChIKey | YUIFVBUXKZHSDD-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.85 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine?
The IUPAC name of 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine (CID 143237546) is 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine.
What is the SMILES notation for 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine?
The canonical SMILES for 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine is CC(OCN1CCN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1)c1ccccc1.
What is the InChIKey of 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine?
The InChIKey is YUIFVBUXKZHSDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25Cl3N2O/c1-18(19-5-3-2-4-6-19)31-17-29-13-14-30(24-12-11-22(27)15-23(24)28)25(16-29)20-7-9-21(26)10-8-20/h2-12,15,18,25H,13-14,16-17H2,1H3.
What are the key properties of 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine?
2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine has a molecular weight of 475.85 g/mol, XLogP of 7.25, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(1-phenylethoxymethyl)piperazine is sourced from PubChem (CID 143237546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).