C22H18N4O5S — CID 110499603
3-benzyl-N-(2-methoxy-5-nitrophenyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 110499603) has the molecular formula C22H18N4O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is 3-benzyl-N-(2-methoxy-5-nitrophenyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3-benzyl-N-(2-methoxy-5-nitrophenyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110499603 |
| Molecular Formula | C22H18N4O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 3-benzyl-N-(2-methoxy-5-nitrophenyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1sc2ncn(Cc3ccccc3)c(=O)c2c1C |
| InChI | InChI=1S/C22H18N4O5S/c1-13-18-21(23-12-25(22(18)28)11-14-6-4-3-5-7-14)32-19(13)20(27)24-16-10-15(26(29)30)8-9-17(16)31-2/h3-10,12H,11H2,1-2H3,(H,24,27) |
| InChIKey | HYQCPZCLNITMSK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|