C22H17FN4O5S — CID 3629716
3-[(3-fluorophenyl)methyl]-N-(2-methoxy-5-nitrophenyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 3629716) has the molecular formula C22H17FN4O5S and a molecular weight of 468.47 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]-N-(2-methoxy-5-nitrophenyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3-[(3-fluorophenyl)methyl]-N-(2-methoxy-5-nitrophenyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 3629716 |
| Molecular Formula | C22H17FN4O5S |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]-N-(2-methoxy-5-nitrophenyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1sc2ncn(Cc3cccc(F)c3)c(=O)c2c1C |
| InChI | InChI=1S/C22H17FN4O5S/c1-12-18-21(24-11-26(22(18)29)10-13-4-3-5-14(23)8-13)33-19(12)20(28)25-16-9-15(27(30)31)6-7-17(16)32-2/h3-9,11H,10H2,1-2H3,(H,25,28) |
| InChIKey | UGWREKUAPZJJRX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|