C16H14N2O6S — CID 110504585
1-[(2-nitrophenyl)sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid (PubChem CID 110504585) has the molecular formula C16H14N2O6S and a molecular weight of 362.36 g/mol. Its IUPAC name is 1-[(2-nitrophenyl)sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid.
| Compound Name | 1-[(2-nitrophenyl)sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 110504585 |
| Molecular Formula | C16H14N2O6S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-[(2-nitrophenyl)sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(NS(=O)(=O)c2ccccc2[N+](=O)[O-])CC1c1ccccc1 |
| InChI | InChI=1S/C16H14N2O6S/c19-15(20)16(10-12(16)11-6-2-1-3-7-11)17-25(23,24)14-9-5-4-8-13(14)18(21)22/h1-9,12,17H,10H2,(H,19,20) |
| InChIKey | DVGWFYNBWXIARP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|