C28H40O17 — CID 11050559
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]methyl]oxan-2-yl]methyl acetate (PubChem CID 11050559) has the molecular formula C28H40O17 and a molecular weight of 648.61 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11050559 |
| Molecular Formula | C28H40O17 |
| Molecular Weight | 648.61 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]methyl]oxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1C[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H40O17/c1-12(29)37-10-21-26(42-17(6)34)27(43-18(7)35)24(40-15(4)32)20(44-21)9-19-23(39-14(3)31)25(41-16(5)33)22(11-38-13(2)30)45-28(19)36-8/h19-28H,9-11H2,1-8H3/t19-,20+,21-,22-,23-,24+,25-,26-,27-,28+/m1/s1 |
| InChIKey | BYNFUBVMXAEUOS-DXAUYPGISA-N |
| XLogP | -0.08 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.61 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|