C16H21N3O8 — CID 110507039
2-[[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-(carboxymethyl)amino]acetic acid (PubChem CID 110507039) has the molecular formula C16H21N3O8 and a molecular weight of 383.36 g/mol. Its IUPAC name is 2-[[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 110507039 |
| Molecular Formula | C16H21N3O8 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[[(Z)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-(carboxymethyl)amino]acetic acid |
| SMILES | CCCCOc1c(OC)cc(/C=N\N(CC(=O)O)CC(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N3O8/c1-3-4-5-27-16-12(19(24)25)6-11(7-13(16)26-2)8-17-18(9-14(20)21)10-15(22)23/h6-8H,3-5,9-10H2,1-2H3,(H,20,21)(H,22,23)/b17-8- |
| InChIKey | MQQIRUQGAWZYBU-IUXPMGMMSA-N |
| XLogP | 1.59 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|