C17H18ClN3O2 — CID 110512249
3-amino-N-[(Z)-(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]benzamide (PubChem CID 110512249) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 3-amino-N-[(Z)-(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-amino-N-[(Z)-(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 110512249 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-amino-N-[(Z)-(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]benzamide |
| SMILES | CC(C)Oc1ccc(/C=N\NC(=O)c2cccc(N)c2)cc1Cl |
| InChI | InChI=1S/C17H18ClN3O2/c1-11(2)23-16-7-6-12(8-15(16)18)10-20-21-17(22)13-4-3-5-14(19)9-13/h3-11H,19H2,1-2H3,(H,21,22)/b20-10- |
| InChIKey | JOFCBGQZDFGAIC-JMIUGGIZSA-N |
| XLogP | 3.47 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|