C23H30ClN3O2 — CID 110512173
3-amino-N-[(Z)-(3-chloro-4-nonoxyphenyl)methylideneamino]benzamide (PubChem CID 110512173) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 3-amino-N-[(Z)-(3-chloro-4-nonoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-amino-N-[(Z)-(3-chloro-4-nonoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 110512173 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-amino-N-[(Z)-(3-chloro-4-nonoxyphenyl)methylideneamino]benzamide |
| SMILES | CCCCCCCCCOc1ccc(/C=N\NC(=O)c2cccc(N)c2)cc1Cl |
| InChI | InChI=1S/C23H30ClN3O2/c1-2-3-4-5-6-7-8-14-29-22-13-12-18(15-21(22)24)17-26-27-23(28)19-10-9-11-20(25)16-19/h9-13,15-17H,2-8,14,25H2,1H3,(H,27,28)/b26-17- |
| InChIKey | PDCNOUBSTVIDTI-ONUIUJJFSA-N |
| XLogP | 5.82 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|