C5H7NO2 — CID 11051610
2,4-dimethyl-4H-1,3-oxazol-5-one (PubChem CID 11051610) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is 2,4-dimethyl-4H-1,3-oxazol-5-one.
| Compound Name | 2,4-dimethyl-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 11051610 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 2,4-dimethyl-4H-1,3-oxazol-5-one |
| SMILES | CC1=NC(C)C(=O)O1 |
| InChI | InChI=1S/C5H7NO2/c1-3-5(7)8-4(2)6-3/h3H,1-2H3 |
| InChIKey | RJUMBKYAQIKACS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |