About 4-methyl-4H-1,3-oxazol-5-one
4-methyl-4H-1,3-oxazol-5-one (PubChem CID 19078029) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is 4-methyl-4H-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 4-methyl-4H-1,3-oxazol-5-one |
| PubChem CID | 19078029 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | 4-methyl-4H-1,3-oxazol-5-one |
| SMILES | CC1C(=O)OC=N1 |
| InChI | InChI=1S/C4H5NO2/c1-3-4(6)7-2-5-3/h2-3H,1H3 |
| InChIKey | HTQKMAGYKHPFQM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 38.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | 119 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-4H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4H-1,3-oxazol-5-one?
The IUPAC name of 4-methyl-4H-1,3-oxazol-5-one (CID 19078029) is 4-methyl-4H-1,3-oxazol-5-one.
What is the SMILES notation for 4-methyl-4H-1,3-oxazol-5-one?
The canonical SMILES for 4-methyl-4H-1,3-oxazol-5-one is CC1C(=O)OC=N1.
What is the InChIKey of 4-methyl-4H-1,3-oxazol-5-one?
The InChIKey is HTQKMAGYKHPFQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2/c1-3-4(6)7-2-5-3/h2-3H,1H3.
What are the key properties of 4-methyl-4H-1,3-oxazol-5-one?
4-methyl-4H-1,3-oxazol-5-one has a molecular weight of 99.09 g/mol, XLogP of 0.20, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4H-1,3-oxazol-5-one is sourced from PubChem (CID 19078029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).