C5H7N3O2 — CID 11051758
(4S,5S)-5-(azidomethyl)-4-deuteriooxolan-2-one (PubChem CID 11051758) has the molecular formula C5H7N3O2 and a molecular weight of 142.14 g/mol. Its IUPAC name is (4S,5S)-5-(azidomethyl)-4-deuteriooxolan-2-one.
| Compound Name | (4S,5S)-5-(azidomethyl)-4-deuteriooxolan-2-one |
|---|---|
| PubChem CID | 11051758 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 142.14 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (4S,5S)-5-(azidomethyl)-4-deuteriooxolan-2-one |
| SMILES | [2H][C@H]1CC(=O)O[C@@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C5H7N3O2/c6-8-7-3-4-1-2-5(9)10-4/h4H,1-3H2/t4-/m0/s1/i1D/t1-,4- |
| InChIKey | ROUYWNFHYZLDLL-IFRNNUGHSA-N |
| XLogP | 1.00 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.14 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|