About (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one
(5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one (PubChem CID 95757491) has the molecular formula C5H5F2N3O2
and a molecular weight of 177.11 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one.
Molecular Properties
| Compound Name | (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one |
| PubChem CID | 95757491 |
| Molecular Formula | C5H5F2N3O2 |
| Molecular Weight | 177.11 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one |
| SMILES | [N-]=[N+]=NC[C@H]1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C5H5F2N3O2/c6-5(7)1-3(2-9-10-8)12-4(5)11/h3H,1-2H2/t3-/m1/s1 |
| InChIKey | DZMHURFSQZAGKK-GSVOUGTGSA-N |
| XLogP | 1.25 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.11 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one?
The IUPAC name of (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one (CID 95757491) is (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one.
What is the SMILES notation for (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one?
The canonical SMILES for (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one is [N-]=[N+]=NC[C@H]1CC(F)(F)C(=O)O1.
What is the InChIKey of (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one?
The InChIKey is DZMHURFSQZAGKK-GSVOUGTGSA-N. The full InChI is InChI=1S/C5H5F2N3O2/c6-5(7)1-3(2-9-10-8)12-4(5)11/h3H,1-2H2/t3-/m1/s1.
What are the key properties of (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one?
(5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one has a molecular weight of 177.11 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(azidomethyl)-3,3-difluorooxolan-2-one is sourced from PubChem (CID 95757491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).