C5H7F2NO2 — CID 106492211
5-(aminomethyl)-3,3-difluorooxolan-2-one (PubChem CID 106492211) has the molecular formula C5H7F2NO2 and a molecular weight of 151.11 g/mol. Its IUPAC name is 5-(aminomethyl)-3,3-difluorooxolan-2-one.
| Compound Name | 5-(aminomethyl)-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492211 |
| Molecular Formula | C5H7F2NO2 |
| Molecular Weight | 151.11 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 5-(aminomethyl)-3,3-difluorooxolan-2-one |
| SMILES | NCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C5H7F2NO2/c6-5(7)1-3(2-8)10-4(5)9/h3H,1-2,8H2 |
| InChIKey | HWLORZGYGMEOFS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.11 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |