C9H15F2NO3 — CID 106492830
3,3-difluoro-5-[[(2-methylpropan-2-yl)oxyamino]methyl]oxolan-2-one (PubChem CID 106492830) has the molecular formula C9H15F2NO3 and a molecular weight of 223.22 g/mol. Its IUPAC name is 3,3-difluoro-5-[[(2-methylpropan-2-yl)oxyamino]methyl]oxolan-2-one.
| Compound Name | 3,3-difluoro-5-[[(2-methylpropan-2-yl)oxyamino]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 106492830 |
| Molecular Formula | C9H15F2NO3 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3,3-difluoro-5-[[(2-methylpropan-2-yl)oxyamino]methyl]oxolan-2-one |
| SMILES | CC(C)(C)ONCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C9H15F2NO3/c1-8(2,3)15-12-5-6-4-9(10,11)7(13)14-6/h6,12H,4-5H2,1-3H3 |
| InChIKey | FNCWXBHUBZLGDG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|