C6H8F3NO2 — CID 130982547
(5R)-5-[(1R)-1-amino-2,2,2-trifluoroethyl]oxolan-2-one (PubChem CID 130982547) has the molecular formula C6H8F3NO2 and a molecular weight of 183.13 g/mol. Its IUPAC name is (5R)-5-[(1R)-1-amino-2,2,2-trifluoroethyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1R)-1-amino-2,2,2-trifluoroethyl]oxolan-2-one |
|---|---|
| PubChem CID | 130982547 |
| Molecular Formula | C6H8F3NO2 |
| Molecular Weight | 183.13 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (5R)-5-[(1R)-1-amino-2,2,2-trifluoroethyl]oxolan-2-one |
| SMILES | N[C@H]([C@H]1CCC(=O)O1)C(F)(F)F |
| InChI | InChI=1S/C6H8F3NO2/c7-6(8,9)5(10)3-1-2-4(11)12-3/h3,5H,1-2,10H2/t3-,5-/m1/s1 |
| InChIKey | CWUMHBMPGXLERF-NQXXGFSBSA-N |
| XLogP | 0.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.13 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |