C6H9F2NO2 — CID 131214130
(5S)-5-[(1S)-1-amino-2,2-difluoroethyl]oxolan-2-one (PubChem CID 131214130) has the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. Its IUPAC name is (5S)-5-[(1S)-1-amino-2,2-difluoroethyl]oxolan-2-one.
| Compound Name | (5S)-5-[(1S)-1-amino-2,2-difluoroethyl]oxolan-2-one |
|---|---|
| PubChem CID | 131214130 |
| Molecular Formula | C6H9F2NO2 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (5S)-5-[(1S)-1-amino-2,2-difluoroethyl]oxolan-2-one |
| SMILES | N[C@H](C(F)F)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C6H9F2NO2/c7-6(8)5(9)3-1-2-4(10)11-3/h3,5-6H,1-2,9H2/t3-,5-/m0/s1 |
| InChIKey | MIUDMEHCWWROPE-UCORVYFPSA-N |
| XLogP | 0.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |