C21H17Cl2N3O3 — CID 110524555
N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-1-[(4-methoxyphenyl)methyl]-2-oxopyridine-3-carboxamide (PubChem CID 110524555) has the molecular formula C21H17Cl2N3O3 and a molecular weight of 430.29 g/mol. Its IUPAC name is N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-1-[(4-methoxyphenyl)methyl]-2-oxopyridine-3-carboxamide.
| Compound Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-1-[(4-methoxyphenyl)methyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 110524555 |
| Molecular Formula | C21H17Cl2N3O3 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-1-[(4-methoxyphenyl)methyl]-2-oxopyridine-3-carboxamide |
| SMILES | COc1ccc(Cn2cccc(C(=O)N/N=C\c3ccc(Cl)c(Cl)c3)c2=O)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O3/c1-29-16-7-4-14(5-8-16)13-26-10-2-3-17(21(26)28)20(27)25-24-12-15-6-9-18(22)19(23)11-15/h2-12H,13H2,1H3,(H,25,27)/b24-12- |
| InChIKey | WMFGRQMKYCBICT-MSXFZWOLSA-N |
| XLogP | 3.98 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|