C23H21Cl2N3O3 — CID 110523896
1-benzyl-N-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2-oxopyridine-3-carboxamide (PubChem CID 110523896) has the molecular formula C23H21Cl2N3O3 and a molecular weight of 458.35 g/mol. Its IUPAC name is 1-benzyl-N-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2-oxopyridine-3-carboxamide.
| Compound Name | 1-benzyl-N-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 110523896 |
| Molecular Formula | C23H21Cl2N3O3 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 1-benzyl-N-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2-oxopyridine-3-carboxamide |
| SMILES | CC(C)Oc1c(Cl)cc(/C=N\NC(=O)c2cccn(Cc3ccccc3)c2=O)cc1Cl |
| InChI | InChI=1S/C23H21Cl2N3O3/c1-15(2)31-21-19(24)11-17(12-20(21)25)13-26-27-22(29)18-9-6-10-28(23(18)30)14-16-7-4-3-5-8-16/h3-13,15H,14H2,1-2H3,(H,27,29)/b26-13- |
| InChIKey | XEQKPDDEVICNIQ-ZMFRSBBQSA-N |
| XLogP | 4.75 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|