C24H25N3O2 — CID 110524073
1-[(4-methylphenyl)methyl]-2-oxo-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 110524073) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-2-oxo-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | 1-[(4-methylphenyl)methyl]-2-oxo-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110524073 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-2-oxo-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | Cc1ccc(Cn2cccc(C(=O)N/N=C\c3ccc(C(C)C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-17(2)21-12-10-19(11-13-21)15-25-26-23(28)22-5-4-14-27(24(22)29)16-20-8-6-18(3)7-9-20/h4-15,17H,16H2,1-3H3,(H,26,28)/b25-15- |
| InChIKey | VSDLNZBVXCFWQG-MYYYXRDXSA-N |
| XLogP | 4.09 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|