C27H31N3O2 — CID 110524614
1-[(4-tert-butylphenyl)methyl]-2-oxo-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 110524614) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-2-oxo-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-2-oxo-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110524614 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-2-oxo-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | CC(C)c1ccc(/C=N\NC(=O)c2cccn(Cc3ccc(C(C)(C)C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C27H31N3O2/c1-19(2)22-12-8-20(9-13-22)17-28-29-25(31)24-7-6-16-30(26(24)32)18-21-10-14-23(15-11-21)27(3,4)5/h6-17,19H,18H2,1-5H3,(H,29,31)/b28-17- |
| InChIKey | HVFDNNDNMAZNLO-QRQIAZFYSA-N |
| XLogP | 5.08 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|