C23H18ClFN2O3S — CID 110525385
[4-[(Z)-[[2-(5-chloro-2-methylsulfanylphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-fluorobenzoate (PubChem CID 110525385) has the molecular formula C23H18ClFN2O3S and a molecular weight of 456.93 g/mol. Its IUPAC name is [4-[(Z)-[[2-(5-chloro-2-methylsulfanylphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-fluorobenzoate.
| Compound Name | [4-[(Z)-[[2-(5-chloro-2-methylsulfanylphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 110525385 |
| Molecular Formula | C23H18ClFN2O3S |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | [4-[(Z)-[[2-(5-chloro-2-methylsulfanylphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-fluorobenzoate |
| SMILES | CSc1ccc(Cl)cc1CC(=O)N/N=C\c1ccc(OC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H18ClFN2O3S/c1-31-21-11-6-18(24)12-17(21)13-22(28)27-26-14-15-2-9-20(10-3-15)30-23(29)16-4-7-19(25)8-5-16/h2-12,14H,13H2,1H3,(H,27,28)/b26-14- |
| InChIKey | AONUWRMTDQCYCK-WGARJPEWSA-N |
| XLogP | 5.11 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|