C19H18N4O3S — CID 110525734
2-oxo-N-[(E)-(2-propoxyphenyl)methylideneamino]-6-thiophen-2-yl-1H-pyrimidine-4-carboxamide (PubChem CID 110525734) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 2-oxo-N-[(E)-(2-propoxyphenyl)methylideneamino]-6-thiophen-2-yl-1H-pyrimidine-4-carboxamide.
| Compound Name | 2-oxo-N-[(E)-(2-propoxyphenyl)methylideneamino]-6-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110525734 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-oxo-N-[(E)-(2-propoxyphenyl)methylideneamino]-6-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
| SMILES | CCCOc1ccccc1/C=N/NC(=O)c1cc(-c2cccs2)[nH]c(=O)n1 |
| InChI | InChI=1S/C19H18N4O3S/c1-2-9-26-16-7-4-3-6-13(16)12-20-23-18(24)15-11-14(21-19(25)22-15)17-8-5-10-27-17/h3-8,10-12H,2,9H2,1H3,(H,23,24)(H,21,22,25)/b20-12+ |
| InChIKey | DWVHKKPOHXTISE-UDWIEESQSA-N |
| XLogP | 3.05 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|