C14H10N4O2S2 — CID 110525744
2-oxo-6-thiophen-2-yl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyrimidine-4-carboxamide (PubChem CID 110525744) has the molecular formula C14H10N4O2S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-oxo-6-thiophen-2-yl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyrimidine-4-carboxamide.
| Compound Name | 2-oxo-6-thiophen-2-yl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110525744 |
| Molecular Formula | C14H10N4O2S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 2-oxo-6-thiophen-2-yl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyrimidine-4-carboxamide |
| SMILES | O=C(N/N=C/c1cccs1)c1cc(-c2cccs2)[nH]c(=O)n1 |
| InChI | InChI=1S/C14H10N4O2S2/c19-13(18-15-8-9-3-1-5-21-9)11-7-10(16-14(20)17-11)12-4-2-6-22-12/h1-8H,(H,18,19)(H,16,17,20)/b15-8+ |
| InChIKey | YKIKCHHMYVTCSL-OVCLIPMQSA-N |
| XLogP | 2.32 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|