C19H18BrN3O3 — CID 110526746
N-[(E)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]-1-methylindole-2-carboxamide (PubChem CID 110526746) has the molecular formula C19H18BrN3O3 and a molecular weight of 416.28 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]-1-methylindole-2-carboxamide.
| Compound Name | N-[(E)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110526746 |
| Molecular Formula | C19H18BrN3O3 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[(E)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]-1-methylindole-2-carboxamide |
| SMILES | COc1cc(Br)cc(/C=N/NC(=O)c2cc3ccccc3n2C)c1OC |
| InChI | InChI=1S/C19H18BrN3O3/c1-23-15-7-5-4-6-12(15)9-16(23)19(24)22-21-11-13-8-14(20)10-17(25-2)18(13)26-3/h4-11H,1-3H3,(H,22,24)/b21-11+ |
| InChIKey | QPMGGBTXTGCXOY-SRZZPIQSSA-N |
| XLogP | 3.72 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|